Difference between revisions of "PWY-6287"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5108 PWY-5108] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C(C(C(C(C([O-])=O)O)O)O)O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M |
* common name: | * common name: | ||
| − | ** L- | + | ** aldehydo-L-galactonate |
| + | * molecular weight: | ||
| + | ** 195.149 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-11152]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name=L- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071] |
| − | {{#set: | + | * BIGG : 3138483 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930] | |
| + | {{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}} | ||
| + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}} | ||
| + | {{#set: common name=aldehydo-L-galactonate}} | ||
| + | {{#set: molecular weight=195.149 }} | ||
| + | {{#set: reversible reaction associated=RXN-11152}} | ||
Revision as of 14:18, 21 March 2018
Contents
Metabolite CPD0-1083
- smiles:
- C(C(C(C(C(C([O-])=O)O)O)O)O)O
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
- common name:
- aldehydo-L-galactonate
- molecular weight:
- 195.149
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(C(C([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.
