Difference between revisions of "2PHENDEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == * smiles: ** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43] ==
* smiles:
+
* taxonomic range:
** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
** InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
** 3-trans-undecenoyl-CoA
+
** putrescine biosynthesis II
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 3E-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-14776]]
+
* [[AGMATINE-DEIMINASE-RXN]]
* [[RXN-14790]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-02_001540]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_003010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659203 90659203]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-43 PWY-43]
{{#set: smiles=CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: inchi key=InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J}}
+
{{#set: taxonomic range=TAX-1239}}
{{#set: common name=3-trans-undecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-1224}}
{{#set: molecular weight=929.765    }}
+
{{#set: common name=putrescine biosynthesis II}}
{{#set: common name=3E-undecenoyl-CoA}}
+
{{#set: reaction found=2}}
{{#set: produced by=RXN-14776|RXN-14790}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=67.0}}

Revision as of 13:19, 21 March 2018

Pathway PWY-43

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links