Difference between revisions of "RXN-7835"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] == * taxonomic range: ** [...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
 +
* inchi key:
 +
** InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K
 
* common name:
 
* common name:
−
** protein N-glycosylation (eukaryotic, high mannose)
+
** UDP
 +
* molecular weight:
 +
** 401.14   
 
* Synonym(s):
 
* Synonym(s):
−
** mannosyl-chito-dolichol biosynthesis
+
** uridine-diphosphate
−
** eukaryotic N-linked glycosylation
+
** uridine-5'-diphosphate
−
** dolichyl-diphosphooligosaccharide biosynthesis and attachment
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''19''' reactions found over '''19''' reactions in the full pathway
+
* [[RXN0-722]]
−
* [[2.4.1.117-RXN]]
+
* [[UDPKIN-RXN]]
−
** 1 associated gene(s):
+
* [[RXN-12197]]
−
*** [[Ec-06_003490]]
+
* [[UDPREDUCT-RXN]]
−
** 2 reconstruction source(s) associated:
+
== Reaction(s) known to produce the compound ==
−
*** [[annotation-esiliculosus_genome]]
+
* [[2.4.1.145-RXN]]
−
*** [[orthology-aragem]]
+
* [[2.4.1.149-RXN]]
−
* [[2.4.1.119-RXN]]
+
* [[2.4.1.223-RXN]]
−
** 7 associated gene(s):
+
* [[RXN1F-461]]
−
*** [[Ec-10_002870]]
+
* [[2.4.1.151-RXN]]
−
*** [[Ec-00_007060]]
+
* [[RXN-4726]]
−
*** [[Ec-22_002490]]
+
−
*** [[Ec-07_004230]]
+
−
*** [[Ec-00_007050]]
+
−
*** [[Ec-14_004370]]
+
−
*** [[Ec-09_000810]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
 
* [[2.4.1.141-RXN]]
 
* [[2.4.1.141-RXN]]
−
** 0 associated gene:
+
* [[2.4.1.144-RXN]]
−
** 1 reconstruction source(s) associated:
+
* [[2.4.1.150-RXN]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
−
* [[2.4.1.142-RXN]]
+
* [[2.4.1.101-RXN]]
−
** 1 associated gene(s):
+
* [[2.4.1.201-RXN]]
−
*** [[Ec-27_000280]]
+
* [[RXN-1224]]
−
** 1 reconstruction source(s) associated:
+
* [[RXN-1225]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-7828]]
−
* [[2.4.1.83-RXN]]
+
* [[TREHALOSE6PSYN-RXN]]
−
** 1 associated gene(s):
+
* [[RXN-4733]]
−
*** [[Ec-01_007940]]
+
* [[RXN-8228]]
−
** 1 reconstruction source(s) associated:
+
* [[2.4.1.46-RXN]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-15278]]
−
* [[2.7.8.15-RXN]]
+
* [[2.4.1.117-RXN]]
−
** 1 associated gene(s):
+
* [[RXN-15277]]
−
*** [[Ec-07_007020]]
+
* [[RXN-15276]]
−
** 2 reconstruction source(s) associated:
+
* [[RXN1F-462]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[2.4.1.155-RXN]]
−
*** [[orthology-aragem]]
+
* [[2.4.1.143-RXN]]
−
* [[RXN-16592]]
+
* [[RXN-12002]]
−
** 0 associated gene:
+
* [[2.4.1.38-RXN]]
−
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
−
*** [[annotation-esiliculosus_genome]]
+
* [[2.4.2.38-RXN]]
−
* [[RXN-16593]]
+
* [[RXN-7873]]
−
** 0 associated gene:
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
** 1 reconstruction source(s) associated:
+
* [[RXN-16027]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-12196]]
−
* [[RXN-16594]]
+
* [[2.4.1.229-RXN]]
−
** 0 associated gene:
+
* [[LACTOSE-SYNTHASE-RXN]]
−
** 1 reconstruction source(s) associated:
+
* [[2.4.1.198-RXN]]
−
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-15117]]
−
* [[RXN-5462]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-03_004420]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5463]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5464]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-05_002900]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5466]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-12_007710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5467]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-12_007710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5468]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-12_007710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5469]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-12_007710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5470]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5471]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-5472]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-18_002280]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 58-98-0
−
{{#set: common name=protein N-glycosylation (eukaryotic, high mannose)}}
+
* BIGG : 33518
−
{{#set: common name=mannosyl-chito-dolichol biosynthesis|eukaryotic N-linked glycosylation|dolichyl-diphosphooligosaccharide biosynthesis and attachment}}
+
* PUBCHEM:
−
{{#set: reaction found=19}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20056717 20056717]
−
{{#set: total reaction=19}}
+
* KNAPSACK : C00007313
−
{{#set: completion rate=100.0}}
+
* HMDB : HMDB00295
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00015 C00015]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.16739715.html 16739715]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58223 58223]
 +
* METABOLIGHTS : MTBLC58223
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}}
 +
{{#set: inchi key=InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K}}
 +
{{#set: common name=UDP}}
 +
{{#set: molecular weight=401.14    }}
 +
{{#set: common name=uridine-diphosphate|uridine-5'-diphosphate}}
 +
{{#set: consumed by=RXN0-722|UDPKIN-RXN|RXN-12197|UDPREDUCT-RXN}}
 +
{{#set: produced by=2.4.1.145-RXN|2.4.1.149-RXN|2.4.1.223-RXN|RXN1F-461|2.4.1.151-RXN|RXN-4726|2.4.1.141-RXN|2.4.1.144-RXN|2.4.1.150-RXN|CELLULOSE-SYNTHASE-UDP-FORMING-RXN|2.4.1.101-RXN|2.4.1.201-RXN|RXN-1224|RXN-1225|RXN-7828|TREHALOSE6PSYN-RXN|RXN-4733|RXN-8228|2.4.1.46-RXN|RXN-15278|2.4.1.117-RXN|RXN-15277|RXN-15276|RXN1F-462|2.4.1.155-RXN|2.4.1.143-RXN|RXN-12002|2.4.1.38-RXN}}
 +
{{#set: reversible reaction associated=2.4.2.38-RXN|RXN-7873|13-BETA-GLUCAN-SYNTHASE-RXN|RXN-16027|RXN-12196|2.4.1.229-RXN|LACTOSE-SYNTHASE-RXN|2.4.1.198-RXN|RXN-15117}}

Revision as of 13:19, 21 March 2018

Metabolite UDP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
  • inchi key:
    • InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K
  • common name:
    • UDP
  • molecular weight:
    • 401.14
  • Synonym(s):
    • uridine-diphosphate
    • uridine-5'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 58-98-0
  • BIGG : 33518
  • PUBCHEM:
  • KNAPSACK : C00007313
  • HMDB : HMDB00295
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • METABOLIGHTS : MTBLC58223
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7835&oldid=17538"