Difference between revisions of "PWY-6802"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] == * smiles: ** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] ==
* smiles:
+
* taxonomic range:
** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
** α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
+
** L-valine degradation II
 
* Synonym(s):
 
* Synonym(s):
 +
** Ehrlich pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[RXN-15271]]
+
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-12_005560]]
 +
*** [[Ec-12_005530]]
 +
*** [[Ec-12_005520]]
 +
*** [[Ec-20_001390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7657 RXN-7657]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: produced by=RXN-15271}}
+
{{#set: common name=L-valine degradation II}}
 +
{{#set: common name=Ehrlich pathway}}
 +
{{#set: reaction found=1}}
 +
{{#set: total reaction=3}}
 +
{{#set: completion rate=33.0}}

Revision as of 13:19, 21 March 2018

Pathway PWY-5057

  • taxonomic range:
  • common name:
    • L-valine degradation II
  • Synonym(s):
    • Ehrlich pathway

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links