Difference between revisions of "GUANOSINE-DIPHOSPHATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-(2-aminophenyl)-2,4-dioxobutanoate
+
** putrescine biosynthesis IV
−
* molecular weight:
+
−
** 206.177   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** putrescine biosynthesis in plants
 +
** ODC and ADC putrescine biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10720]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[AGMATIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
−
* [[2.6.1.7-RXN]]
+
*** [[Ec-17_004300]]
 +
*** [[Ec-22_003700]]
 +
*** [[Ec-17_004310]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ARGINASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_001100]]
 +
*** [[Ec-22_003700]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ORNDECARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003270]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615302 23615302]
+
{{#set: common name=putrescine biosynthesis IV}}
−
* HMDB : HMDB00978
+
{{#set: common name=putrescine biosynthesis in plants|ODC and ADC putrescine biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01252 C01252]
+
{{#set: total reaction=4}}
−
* CHEMSPIDER:
+
{{#set: completion rate=75.0}}
−
** [http://www.chemspider.com/Chemical-Structure.19951260.html 19951260]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58147 58147]
+
−
* METABOLIGHTS : MTBLC58147
+
−
{{#set: smiles=C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
+
−
{{#set: molecular weight=206.177    }}
+
−
{{#set: consumed by=RXN-10720}}
+
−
{{#set: reversible reaction associated=2.6.1.7-RXN}}
+

Revision as of 14:19, 21 March 2018

Pathway PWY-6305

  • taxonomic range:
  • common name:
    • putrescine biosynthesis IV
  • Synonym(s):
    • putrescine biosynthesis in plants
    • ODC and ADC putrescine biosynthesis

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GUANOSINE-DIPHOSPHATASE-RXN&oldid=17555"