Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7659 RXN-7659] == * direction: ** LEFT-TO-RIGHT * common name: ** Geranylgeranyl reductase * Sy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7659 RXN-7659] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Geranylgeranyl reductase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-7002]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CPD-7003]][c] '''+''' 1 [[NADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 dihydrogeranylgeranyl diphosphate[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 tetrahydrogeranylgeranyl diphosphate[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-03_003520]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5063]], phytyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08755 R08755] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Geranylgeranyl reductase}} | |
− | * LIGAND- | + | {{#set: gene associated=Ec-03_003520}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5063}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:19, 21 March 2018
Contents
Reaction RXN-7659
- direction:
- LEFT-TO-RIGHT
- common name:
- Geranylgeranyl reductase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 dihydrogeranylgeranyl diphosphate[c] + 1 H+[c] + 1 NADPH[c] => 1 tetrahydrogeranylgeranyl diphosphate[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_003520
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5063, phytyl diphosphate biosynthesis: PWY-5063
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: