Difference between revisions of "TOLUENE-DEG-CATECHOL-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
* inchi key:
+
** InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J
+
 
* common name:
 
* common name:
** 5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** ascorbate recycling (cytosolic)
* molecular weight:
+
** 985.786   
+
 
* Synonym(s):
 
* Synonym(s):
** 5OH-HIP-CoA
+
** vitamin C recycling (cytosolic)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
* [[RXN-12747]]
+
* [[1.6.5.4-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-26_002470]]
 +
*** [[Ec-22_003850]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[1.8.5.1-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-02_003740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10981]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-3523]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10980 RXN-10980]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3522 RXN-3522]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-MAP:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86290216 86290216]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00053 map00053]
* CHEBI:
+
{{#set: taxonomic range=TAX-7742}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83738 83738]
+
{{#set: common name=ascorbate recycling (cytosolic)}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: common name=vitamin C recycling (cytosolic)}}
{{#set: inchi key=InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J}}
+
{{#set: reaction found=4}}
{{#set: common name=5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: total reaction=6}}
{{#set: molecular weight=985.786    }}
+
{{#set: completion rate=67.0}}
{{#set: common name=5OH-HIP-CoA}}
+
{{#set: produced by=RXN-12747}}
+

Revision as of 14:19, 21 March 2018

Pathway PWY-6370

  • taxonomic range:
  • common name:
    • ascorbate recycling (cytosolic)
  • Synonym(s):
    • vitamin C recycling (cytosolic)

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links