Difference between revisions of "CPD-476"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] == * smiles: ** C1(C=C(O)C(=CC=1C(C[N+])O)O) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** superpathway of L-aspartate and L-asparagine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Interconversion of L-aspartate and L-asparagine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''7''' reactions in the full pathway | |
− | * [[ | + | * [[ASPARAGHYD-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Ec-11_002360]] | ||
+ | *** [[Ec-27_003980]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ASPARAGINESYN-PWY]] | ||
+ | ** 0 associated gene: | ||
+ | * [[ASPARTATESYN-PWY]] | ||
+ | ** 0 associated gene: | ||
+ | * [[GLUTDEG-PWY]] | ||
+ | ** 0 associated gene: | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=superpathway of L-aspartate and L-asparagine biosynthesis}} | |
− | + | {{#set: common name=Interconversion of L-aspartate and L-asparagine}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=57.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:19, 21 March 2018
Pathway ASPASN-PWY
- taxonomic range:
- common name:
- superpathway of L-aspartate and L-asparagine biosynthesis
- Synonym(s):
- Interconversion of L-aspartate and L-asparagine
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- ASPARAGHYD-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ASPARAGINESYN-PWY
- 0 associated gene:
- ASPARTATESYN-PWY
- 0 associated gene:
- GLUTDEG-PWY
- 0 associated gene:
Reaction(s) not found
External links
- ECOCYC: