Difference between revisions of "TRNA-containing-5Me-uridine54"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * smiles: ** CC(C)(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=JTEYKUFKXGD...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
** CC(C)(O)C(O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
 
* common name:
 
* common name:
−
** C4 photosynthetic carbon assimilation cycle, NADP-ME type
+
** (2R)-2,3-dihydroxy-3-methylbutanoate
 +
* molecular weight:
 +
** 133.124   
 
* Synonym(s):
 
* Synonym(s):
−
** PCA cycle
+
** (R)-2,3-dihydroxy-3-methylbutanoate
−
** C4 photosynthesis, NADP-ME type
+
** (R)-2,3-dihydroxy-isovalerate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''5''' reactions in the full pathway
+
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
−
* [[MALIC-NADP-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-01_003680]]
+
* [[ACETOLACTREDUCTOISOM-RXN]]
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPCARBOX-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-28_003470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-18_001310]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN0-5224]]
+
−
** 8 associated gene(s):
+
−
*** [[Ec-05_001290]]
+
−
*** [[Ec-10_002770]]
+
−
*** [[Ec-27_005680]]
+
−
*** [[Ec-07_004610]]
+
−
*** [[Ec-16_004700]]
+
−
*** [[Ec-22_001150]]
+
−
*** [[Ec-06_004120]]
+
−
*** [[Ec-03_001960]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=MALATE-DEHYDROGENASE-NADP+-RXN MALATE-DEHYDROGENASE-NADP+-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-3193}}
+
* LIGAND-CPD:
−
{{#set: common name=C4 photosynthetic carbon assimilation cycle, NADP-ME type}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272]
−
{{#set: common name=PCA cycle|C4 photosynthesis, NADP-ME type}}
+
* CHEMSPIDER:
−
{{#set: reaction found=4}}
+
** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355]
−
{{#set: total reaction=5}}
+
* CHEBI:
−
{{#set: completion rate=80.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351]
 +
* HMDB : HMDB12141
 +
{{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}}
 +
{{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}}
 +
{{#set: molecular weight=133.124    }}
 +
{{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}}
 +
{{#set: consumed by=DIHYDROXYISOVALDEHYDRAT-RXN}}
 +
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN}}

Revision as of 13:19, 21 March 2018

Metabolite CPD-13357

  • smiles:
    • CC(C)(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
  • common name:
    • (2R)-2,3-dihydroxy-3-methylbutanoate
  • molecular weight:
    • 133.124
  • Synonym(s):
    • (R)-2,3-dihydroxy-3-methylbutanoate
    • (R)-2,3-dihydroxy-isovalerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRNA-containing-5Me-uridine54&oldid=17611"