Difference between revisions of "3-oxo-myristoyl-ACPs"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == * smiles: ** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | + | * inchi key: | |
− | + | ** InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J | |
− | + | ||
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** 3 | + | ** 3-trans-undecenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 929.765 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3E-undecenoyl-CoA |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14776]] | |
− | + | * [[RXN-14790]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659203 90659203] | |
− | {{#set: | + | {{#set: smiles=CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | + | {{#set: inchi key=InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J}} | |
− | + | {{#set: common name=3-trans-undecenoyl-CoA}} | |
− | + | {{#set: molecular weight=929.765 }} | |
− | + | {{#set: common name=3E-undecenoyl-CoA}} | |
− | {{#set: | + | {{#set: produced by=RXN-14776|RXN-14790}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:19, 21 March 2018
Contents
Metabolite CPD-15655
- smiles:
- CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J
- common name:
- 3-trans-undecenoyl-CoA
- molecular weight:
- 929.765
- Synonym(s):
- 3E-undecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.