Difference between revisions of "PWY-7033"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-oxolanosterol deformylas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M
 
* common name:
 
* common name:
** 14-oxolanosterol deformylase
+
** 4-(2-aminophenyl)-2,4-dioxobutanoate
** Cytochrome P450
+
* molecular weight:
 +
** 206.177   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10720]]
** 1 [[CPD-4573]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 14-oxolanosterol[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''=>''' 1 NADP+[c] '''+''' 1 formate[c] '''+''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] '''+''' 1 H2O[c]
+
* [[2.6.1.7-RXN]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-10_006240]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
** '''9''' reactions found over '''22''' reactions in the full pathway
+
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
** '''9''' reactions found over '''22''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=14-oxolanosterol deformylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615302 23615302]
{{#set: common name=Cytochrome P450}}
+
* HMDB : HMDB00978
{{#set: gene associated=Ec-10_006240}}
+
* LIGAND-CPD:
{{#set: in pathway=PWY66-341|PWY66-4}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01252 C01252]
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.chemspider.com/Chemical-Structure.19951260.html 19951260]
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58147 58147]
 +
* METABOLIGHTS : MTBLC58147
 +
{{#set: smiles=C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O}}
 +
{{#set: inchi key=InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M}}
 +
{{#set: common name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
 +
{{#set: molecular weight=206.177    }}
 +
{{#set: consumed by=RXN-10720}}
 +
{{#set: reversible reaction associated=2.6.1.7-RXN}}

Revision as of 13:19, 21 March 2018

Metabolite CPD-476

  • smiles:
    • C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O
  • inchi key:
    • InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M
  • common name:
    • 4-(2-aminophenyl)-2,4-dioxobutanoate
  • molecular weight:
    • 206.177
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O" cannot be used as a page name in this wiki.