Difference between revisions of "GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs-with-queuine tRNAs-with-queuine] == * common name: ** a queuosine34 in tRNA * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs-with-queuine tRNAs-with-queuine] ==
* smiles:
+
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
* inchi key:
+
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** cyanidin
+
** a queuosine34 in tRNA
* molecular weight:
+
** 285.232   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
+
** a tRNA containing queuosine
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
+
** queuosine at position 34 of a tRNA
** 3,3',4',5,7-pentahydroxyflavylium
+
** cyanidol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9725]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-602]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a queuosine34 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
{{#set: common name=a tRNA containing queuosine|queuosine at position 34 of a tRNA}}
* CHEBI:
+
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
* HMDB : HMDB02708
+
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
{{#set: common name=cyanidin}}
+
{{#set: molecular weight=285.232    }}
+
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
{{#set: consumed by=RXN-9725}}
+
{{#set: produced by=RXN-602}}
+

Revision as of 13:20, 21 March 2018

Metabolite tRNAs-with-queuine

  • common name:
    • a queuosine34 in tRNA
  • Synonym(s):
    • a tRNA containing queuosine
    • queuosine at position 34 of a tRNA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links