Difference between revisions of "GMP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_001980 == * left end position: ** 1984249 * transcription direction: ** NEGATIVE * right end position: ** 1998471 * centisome position: ** 30.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)CCCC(C(=O)[O-])[N+] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M |
− | * | + | * common name: |
− | ** | + | ** L-2-aminoadipate |
− | * | + | * molecular weight: |
− | ** | + | ** 160.149 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-aminoadipic acid |
− | ** | + | ** L-aminoadipate |
+ | ** L-2-amino-hexanedioic acid | ||
+ | ** L-α-aminoadipate | ||
+ | ** L-α-aminoadipic acid | ||
+ | ** L-2-aminoadipic acid | ||
+ | ** L-2-aminohexanedioate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10855]] | |
− | + | * [[1.2.1.31-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
+ | * [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1118-90-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992111 6992111] |
− | {{#set: | + | * HMDB : HMDB00510 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00956 C00956] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5360261.html 5360261] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58672 58672] | ||
+ | * METABOLIGHTS : MTBLC58672 | ||
+ | {{#set: smiles=C([O-])(=O)CCCC(C(=O)[O-])[N+]}} | ||
+ | {{#set: inchi key=InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M}} | ||
+ | {{#set: common name=L-2-aminoadipate}} | ||
+ | {{#set: molecular weight=160.149 }} | ||
+ | {{#set: common name=L-aminoadipic acid|L-aminoadipate|L-2-amino-hexanedioic acid|L-α-aminoadipate|L-α-aminoadipic acid|L-2-aminoadipic acid|L-2-aminohexanedioate}} | ||
+ | {{#set: produced by=RXN-10855|1.2.1.31-RXN}} | ||
+ | {{#set: reversible reaction associated=2-AMINOADIPATE-AMINOTRANSFERASE-RXN}} |
Revision as of 14:20, 21 March 2018
Contents
Metabolite CPD-468
- smiles:
- C([O-])(=O)CCCC(C(=O)[O-])[N+]
- inchi key:
- InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M
- common name:
- L-2-aminoadipate
- molecular weight:
- 160.149
- Synonym(s):
- L-aminoadipic acid
- L-aminoadipate
- L-2-amino-hexanedioic acid
- L-α-aminoadipate
- L-α-aminoadipic acid
- L-2-aminoadipic acid
- L-2-aminohexanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1118-90-7
- PUBCHEM:
- HMDB : HMDB00510
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58672
"C([O-])(=O)CCCC(C(=O)[O-])[N+" cannot be used as a page name in this wiki.