Difference between revisions of "CPD-2187"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-14_005260 == * left end position: ** 4846153 * transcription direction: ** NEGATIVE * right end position: ** 4853916 * centisome position: ** 73.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+
== Gene Ec-14_005260 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4846153
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-methyl-3-oxo-4-hexenoyl-CoA
+
** 4853916
−
* molecular weight:
+
* centisome position:
−
** 887.641    
+
** 73.86947    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0100_0085
 +
** Esi0100_0085
 +
** NIN-like 4
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11921]]
+
* Reaction: [[RIBOFLAVINKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY66-366]]
 +
* [[PWY-6168]]
 +
* [[RIBOSYN2-PWY]]
 +
* [[PWY-5523]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4846153}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=4853916}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471]
+
{{#set: centisome position=73.86947    }}
−
* HMDB : HMDB60399
+
{{#set: common name=Esi_0100_0085|Esi0100_0085|NIN-like 4}}
−
{{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RIBOFLAVINKIN-RXN}}
−
{{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}}
+
{{#set: pathway associated=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}}
−
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}}
+
−
{{#set: molecular weight=887.641    }}
+
−
{{#set: consumed by=RXN-11921}}
+

Revision as of 13:20, 21 March 2018

Gene Ec-14_005260

  • left end position:
    • 4846153
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4853916
  • centisome position:
    • 73.86947
  • Synonym(s):
    • Esi_0100_0085
    • Esi0100_0085
    • NIN-like 4

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-2187&oldid=17696"