Difference between revisions of "RXN0-1441"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == |
* smiles: | * smiles: | ||
| − | ** C1( | + | ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** cyanidin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 285.232 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium |
| − | ** | + | ** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium |
| − | ** | + | ** 3,3',4',5,7-pentahydroxyflavylium |
| + | ** cyanidol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9725]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C1( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB02708 |
| − | {{#set: common name= | + | {{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=cyanidin}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=285.232 }} |
| − | {{#set: produced by= | + | {{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}} |
| + | {{#set: consumed by=RXN-9725}} | ||
| + | {{#set: produced by=RXN-602}} | ||
Revision as of 13:20, 21 March 2018
Contents
Metabolite CPD-591
- smiles:
- C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
- inchi key:
- InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
- common name:
- cyanidin
- molecular weight:
- 285.232
- Synonym(s):
- 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
- 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
- 3,3',4',5,7-pentahydroxyflavylium
- cyanidol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)" cannot be used as a page name in this wiki.
