Difference between revisions of "CPD-5168"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''12''' reactions in the full pathway |
− | == Reaction(s) | + | * [[RXN-14785]] |
− | == | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[Ec-22_002920]] |
+ | *** [[Ec-26_004320]] | ||
+ | *** [[Ec-08_006390]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-14789]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-22_002920]] | ||
+ | *** [[Ec-26_004320]] | ||
+ | *** [[Ec-08_006390]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-14790]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_003950]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14777 RXN-14777] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14778 RXN-14778] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14779 RXN-14779] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14780 RXN-14780] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14781 RXN-14781] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14784 RXN-14784] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14786 RXN-14786] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14787 RXN-14787] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14788 RXN-14788] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=12}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:20, 21 March 2018
Pathway PWY-7338
- taxonomic range:
- common name:
- 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)
- Synonym(s):
Reaction(s) found
3 reactions found over 12 reactions in the full pathway
- RXN-14785
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14789
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14790
- 1 associated gene(s):
- 1 reconstruction source(s) associated: