Difference between revisions of "CPD-17331"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Gene == Gene Ec-20_000940 == * left end position: ** 891809 * transcription direction: ** POSITIVE * right end position: ** 904680 * centisome position: ** 17.295...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_000940 == |
− | * | + | * left end position: |
− | ** | + | ** 891809 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 904680 |
− | * | + | * centisome position: |
− | ** | + | ** 17.295116 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0195_0025 |
− | ** | + | ** Esi0195_0025 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.10.1-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=891809}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=904680}} | |
− | + | {{#set: centisome position=17.295116 }} | |
− | + | {{#set: common name=Esi_0195_0025|Esi0195_0025}} | |
− | + | {{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:20, 21 March 2018
Gene Ec-20_000940
- left end position:
- 891809
- transcription direction:
- POSITIVE
- right end position:
- 904680
- centisome position:
- 17.295116
- Synonym(s):
- Esi_0195_0025
- Esi0195_0025
Reactions associated
- Reaction: 2.7.10.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome