Difference between revisions of "RXN0-4961"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** octane oxidation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[R222-RXN]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[R223-RXN]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Ec-02_006430]] | ||
| + | *** [[Ec-12_008720]] | ||
| + | *** [[Ec-03_003710]] | ||
| + | *** [[Ec-01_001560]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ALKANE-1-MONOOXYGENASE-RXN ALKANE-1-MONOOXYGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=R221-RXN R221-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RUBREDOXIN--NAD+-REDUCTASE-RXN RUBREDOXIN--NAD+-REDUCTASE-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * UM-BBD-PWY : oct |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: common name=octane oxidation}} |
| − | {{#set: common name= | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=40.0}} |
Revision as of 13:21, 21 March 2018
Pathway P221-PWY
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- R222-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- R223-RXN
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : oct
