Difference between revisions of "Ec-16 004670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] == * common name: ** a reduced glutaredoxin * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] ==
* smiles:
+
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
+
* inchi key:
+
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
+
 
* common name:
 
* common name:
** strictosidine
+
** a reduced glutaredoxin
* molecular weight:
+
** 531.581   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-α(S)-strictosidine
+
** glutaredoxin (reduced)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
* [[PRODISULFREDUCT-A-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 20824-29-7
+
{{#set: common name=a reduced glutaredoxin}}
* PUBCHEM:
+
{{#set: common name=glutaredoxin (reduced)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
+
{{#set: consumed by=RXN-982}}
* CHEBI:
+
{{#set: produced by=PRODISULFREDUCT-A-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
+
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
+
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
+
{{#set: common name=strictosidine}}
+
{{#set: molecular weight=531.581    }}
+
{{#set: common name=3-α(S)-strictosidine}}
+
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Revision as of 13:21, 21 March 2018

Metabolite Red-Glutaredoxins

  • common name:
    • a reduced glutaredoxin
  • Synonym(s):
    • glutaredoxin (reduced)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links