Difference between revisions of "Ec-26 002470"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_003080 == * Synonym(s): ** Esi_0327_0021 ** Esi0327_0021 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == |
| + | * smiles: | ||
| + | ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L | ||
| + | * common name: | ||
| + | ** γ-L-glutamyl 5-phosphate | ||
| + | * molecular weight: | ||
| + | ** 225.094 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-glutamate 5-phosphate |
| − | ** | + | ** γ-L-glutamyl-5-P |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[GLUTSEMIALDEHYDROG-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[GLUTKIN-RXN]] |
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * BIGG : 41564 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44457531 44457531] | ||
| + | * HMDB : HMDB01228 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03287 C03287] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58274 58274] | ||
| + | * METABOLIGHTS : MTBLC58274 | ||
| + | {{#set: smiles=C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L}} | ||
| + | {{#set: common name=γ-L-glutamyl 5-phosphate}} | ||
| + | {{#set: molecular weight=225.094 }} | ||
| + | {{#set: common name=L-glutamate 5-phosphate|γ-L-glutamyl-5-P}} | ||
| + | {{#set: consumed by=GLUTSEMIALDEHYDROG-RXN}} | ||
| + | {{#set: produced by=GLUTKIN-RXN}} | ||
Revision as of 13:21, 21 March 2018
Contents
Metabolite L-GLUTAMATE-5-P
- smiles:
- C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L
- common name:
- γ-L-glutamyl 5-phosphate
- molecular weight:
- 225.094
- Synonym(s):
- L-glutamate 5-phosphate
- γ-L-glutamyl-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 41564
- PUBCHEM:
- HMDB : HMDB01228
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58274
"C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
