Difference between revisions of "Ec-18 002510"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
 +
* inchi key:
 +
** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
 
* common name:
 
* common name:
−
** formaldehyde assimilation III (dihydroxyacetone cycle)
+
** β-D-cellobiose
 +
* molecular weight:
 +
** 342.299   
 
* Synonym(s):
 
* Synonym(s):
−
** dihydroxyacetone cycle
+
** 4-O-β-D-glucopyranosyl-β-D-glucopyranose
−
** xylulose-monophosphate cycle
+
** β-D-glucosyl-(1→4)-β-D-glucose
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''11''' reactions found over '''12''' reactions in the full pathway
+
* [[RXN-10773]]
−
* [[1TRANSKETO-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-20_002600]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[2TRANSKETO-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-20_002600]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[F16ALDOLASE-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-10_000880]]
+
−
*** [[Ec-10_004980]]
+
−
*** [[Ec-14_001680]]
+
−
*** [[Ec-01_008040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[F16BDEPHOS-RXN]]
+
−
** 7 associated gene(s):
+
−
*** [[Ec-12_004070]]
+
−
*** [[Ec-04_004710]]
+
−
*** [[Ec-14_005760]]
+
−
*** [[Ec-06_004200]]
+
−
*** [[Ec-17_003090]]
+
−
*** [[Ec-21_001790]]
+
−
*** [[Ec-22_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[GAPOXNPHOSPHN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-25_003550]]
+
−
*** [[Ec-19_001850]]
+
−
*** [[Ec-19_003020]]
+
−
*** [[Ec-08_000500]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[GLYCERONE-KINASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-18_002130]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PHOSGLYPHOS-RXN]]
+
−
** 6 associated gene(s):
+
−
*** [[Ec-12_004530]]
+
−
*** [[Ec-01_001350]]
+
−
*** [[Ec-08_002400]]
+
−
*** [[Ec-12_004550]]
+
−
*** [[Ec-21_005710]]
+
−
*** [[Ec-21_004220]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RIB5PISOM-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-08_003540]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RIBULP3EPIM-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-07_002390]]
+
−
*** [[Ec-27_003930]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[TRANSALDOL-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-01_002780]]
+
−
*** [[Ec-06_003940]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-08_000500]]
+
−
*** [[Ec-23_004160]]
+
−
*** [[Ec-03_002790]]
+
−
*** [[Ec-24_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=FORMALDEHYDE-TRANSKETOLASE-RXN FORMALDEHYDE-TRANSKETOLASE-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* CAS : 528-50-7
−
{{#set: common name=formaldehyde assimilation III (dihydroxyacetone cycle)}}
+
* PUBCHEM:
−
{{#set: common name=dihydroxyacetone cycle|xylulose-monophosphate cycle}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712]
−
{{#set: reaction found=11}}
+
* HMDB : HMDB00055
−
{{#set: total reaction=12}}
+
* LIGAND-CPD:
−
{{#set: completion rate=92.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10261.html 10261]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217]
 +
{{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}}
 +
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}}
 +
{{#set: common name=β-D-cellobiose}}
 +
{{#set: molecular weight=342.299    }}
 +
{{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}}
 +
{{#set: consumed by=RXN-10773}}

Revision as of 14:21, 21 March 2018

Metabolite CELLOBIOSE

  • smiles:
    • C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
  • inchi key:
    • InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
  • common name:
    • β-D-cellobiose
  • molecular weight:
    • 342.299
  • Synonym(s):
    • 4-O-β-D-glucopyranosyl-β-D-glucopyranose
    • β-D-glucosyl-(1→4)-β-D-glucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_002510&oldid=17933"