Difference between revisions of "PWY66-368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** pentose phosphate pathway (non-oxidative branch) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''5''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[1TRANSKETO-RXN]] | |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Ec-20_002600]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[2TRANSKETO-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-20_002600]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RIB5PISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-08_003540]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RIBULP3EPIM-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-07_002390]] | ||
+ | *** [[Ec-27_003930]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[TRANSALDOL-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-06_003940]] | ||
+ | *** [[Ec-01_002780]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2759}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=pentose phosphate pathway (non-oxidative branch)}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:22, 21 March 2018
Pathway NONOXIPENT-PWY
- taxonomic range:
- common name:
- pentose phosphate pathway (non-oxidative branch)
- Synonym(s):
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- 1TRANSKETO-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2TRANSKETO-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RIB5PISOM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RIBULP3EPIM-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- TRANSALDOL-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: