Difference between revisions of "CPD-14927"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-LYSINE EIF5A-LYSINE] == * common name: ** an [eIF5A-precursor]-lysine * Synonym(s): ** an...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-LYSINE EIF5A-LYSINE] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [eIF5A-precursor]-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an eIF5A-L-lysine |
| − | + | ** an eIF5A lysine | |
| − | ** | + | |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13416]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.5.1.46-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an [eIF5A-precursor]-lysine}} | |
| − | + | {{#set: common name=an eIF5A-L-lysine|an eIF5A lysine}} | |
| − | + | {{#set: consumed by=RXN-13416}} | |
| − | + | {{#set: reversible reaction associated=2.5.1.46-RXN}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 13:23, 21 March 2018
Contents
Metabolite EIF5A-LYSINE
- common name:
- an [eIF5A-precursor]-lysine
- Synonym(s):
- an eIF5A-L-lysine
- an eIF5A lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [eIF5A-precursor]-lysine" cannot be used as a page name in this wiki.
