|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) |
| + | * inchi key: |
| + | ** InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N |
| * common name: | | * common name: |
− | ** Cytochrome b6-f complex Fe-S subunit | + | ** L-tryptophan |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.10.9.1 EC-1.10.9.1] | + | ** 204.228 |
| * Synonym(s): | | * Synonym(s): |
| + | ** trp |
| + | ** W |
| + | ** tryptacin |
| + | ** trofan |
| + | ** tryptophan |
| + | ** 2-amino-3-indolylpropanic acid |
| + | ** L-trp |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers: | + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] |
− | ** 2 [[PROTON]][e] '''+''' 2 [[Oxidized-Plastocyanins]][c] '''+''' 1 [[Plastoquinols]][c] '''=>''' 2 [[Plastocyanin-Reduced]][c] '''+''' 4 [[PROTON]][c] '''+''' 1 [[PLASTOQUINONE]][c]
| + | * [[biomass_rxn]] |
− | * With common name(s): | + | * [[RXN-8665]] |
− | ** 2 H+[e] '''+''' 2 an oxidized plastocyanin[c] '''+''' 1 a plastoquinol[c] '''=>''' 2 a reduced plastocyanin[c] '''+''' 4 H+[c] '''+''' 1 a plastoquinone[c]
| + | == Reaction(s) known to produce the compound == |
− | | + | * [[TRYPSYN-RXN]] |
− | == Genes associated with this reaction == | + | * [[RXN0-2382]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | == Reaction(s) of unknown directionality == |
− | * [[Ec-05_006690]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-101]], photosynthesis light reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY-101 PWY-101] | + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * CAS : 73-22-3 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03817 R03817]
| + | * BIGG : 33772 |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P12120 P12120] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923516 6923516] |
− | ** [http://www.uniprot.org/uniprot/P06669 P06669] | + | * HMDB : HMDB00929 |
− | ** [http://www.uniprot.org/uniprot/P12122 P12122]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P69457 P69457]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00078 C00078] |
− | ** [http://www.uniprot.org/uniprot/P49728 P49728] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P27589 P27589] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57912 57912] |
− | ** [http://www.uniprot.org/uniprot/P13347 P13347] | + | * METABOLIGHTS : MTBLC57912 |
− | ** [http://www.uniprot.org/uniprot/P06248 P06248] | + | {{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}} |
− | ** [http://www.uniprot.org/uniprot/P06247 P06247] | + | {{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N}} |
− | ** [http://www.uniprot.org/uniprot/P12123 P12123]
| + | {{#set: common name=L-tryptophan}} |
− | ** [http://www.uniprot.org/uniprot/P00165 P00165]
| + | {{#set: molecular weight=204.228 }} |
− | ** [http://www.uniprot.org/uniprot/P05642 P05642] | + | {{#set: common name=trp|W|tryptacin|trofan|tryptophan|2-amino-3-indolylpropanic acid|L-trp}} |
− | ** [http://www.uniprot.org/uniprot/P06246 P06246]
| + | {{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN|biomass_rxn|RXN-8665}} |
− | ** [http://www.uniprot.org/uniprot/P06449 P06449]
| + | {{#set: produced by=TRYPSYN-RXN|RXN0-2382}} |
− | ** [http://www.uniprot.org/uniprot/P00155 P00155]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07888 P07888]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12361 P12361]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZR03 Q9ZR03]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16013 P16013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04658 P04658]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08980 P08980]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11093 P11093]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14236 P14236]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05151 P05151]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06527 P06527]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60161 P60161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60162 P60162]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12119 P12119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26290 P26290]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26287 P26287]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23577 P23577]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23230 P23230]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30398 P30398]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00471 Q00471]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28058 P28058]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28059 P28059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30361 P30361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30396 P30396]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26291 P26291]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08362 Q08362]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31480 P31480]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46136 Q46136]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36438 P36438]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46304 P46304]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46617 P46617]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05643 P05643]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69454 P69454]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51318 P51318]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51341 P51341]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74149 P74149]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74174 P74174]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57038 Q57038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74714 P74714]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49488 P49488]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49489 P49489]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49470 P49470]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49476 P49476]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48611 O48611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49161 P49161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48122 P48122]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48121 P48121]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48123 P48123]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56322 P56322]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56321 P56321]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56305 P56305]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56306 P56306]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41614 P41614]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41619 P41619]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41628 P41628]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52770 P52770]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69460 P69460]
| + | |
− | ** [http://www.uniprot.org/uniprot/O47042 O47042]
| + | |
− | ** [http://www.uniprot.org/uniprot/O47043 O47043]
| + | |
− | ** [http://www.uniprot.org/uniprot/O47044 O47044]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZGG1 Q9ZGG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZGG0 Q9ZGG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13348 P13348]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06250 P06250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12118 P12118]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69459 P69459]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00166 P00166]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Cytochrome b6-f complex Fe-S subunit}} | + | |
− | {{#set: ec number=EC-1.10.9.1}} | + | |
− | {{#set: gene associated=Ec-05_006690}} | + | |
− | {{#set: in pathway=PWY-101}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |