Difference between revisions of "PWY-7193"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_004400 == * left end position: ** 4176294 * transcription direction: ** POSITIVE * right end position: ** 4183387 * centisome position: ** 63.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M |
| − | * | + | * common name: |
| − | ** | + | ** leukotriene-D4 |
| − | * | + | * molecular weight: |
| − | ** | + | ** 495.653 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-336]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166] |
| − | {{#set: common name= | + | {{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}} |
| − | {{#set: | + | {{#set: common name=leukotriene-D4}} |
| + | {{#set: molecular weight=495.653 }} | ||
| + | {{#set: produced by=RXN66-336}} | ||
Revision as of 13:23, 21 March 2018
Contents
Metabolite CPD66-21
- smiles:
- CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
- inchi key:
- InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
- common name:
- leukotriene-D4
- molecular weight:
- 495.653
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O" cannot be used as a page name in this wiki.
