Difference between revisions of "Ec-01 008240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-5-enoyl-CoA cis-5-enoyl-CoA] == * common name: ** a cis-5-enoyl-CoA * Synonym(s): ** cis-&D...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == |
+ | * smiles: | ||
+ | ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol 6-monophosphate |
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Ins(6)P1 |
+ | ** 1D-myo-inositol 6-phosphate | ||
+ | ** Ins(6)P | ||
+ | ** Ins6P | ||
+ | ** D-myo-inositol 6-monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10954]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035] |
− | {{#set: consumed by=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841] | ||
+ | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}} | ||
+ | {{#set: common name=1D-myo-inositol 6-monophosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}} | ||
+ | {{#set: consumed by=RXN-10954}} |
Revision as of 13:23, 21 March 2018
Contents
Metabolite CPD-6702
- smiles:
- C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
- inchi key:
- InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
- common name:
- 1D-myo-inositol 6-monophosphate
- molecular weight:
- 258.121
- Synonym(s):
- Ins(6)P1
- 1D-myo-inositol 6-phosphate
- Ins(6)P
- Ins6P
- D-myo-inositol 6-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.