Difference between revisions of "CHD-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] ==
−
* smiles:
+
* direction:
−
** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
+
−
* common name:
+
−
** CDP-choline
+
−
* molecular weight:
+
−
** 487.319   
+
 
* Synonym(s):
 
* Synonym(s):
−
** citicoline
 
−
** citicholine
 
−
** cidifos
 
−
** cyticholine
 
−
** cytidine 5'-diphosphocholine
 
−
** cytidine diphosphate choline
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2.7.7.15-RXN]]
+
** 1.0 [[CU+2]][e] '''=>''' 1.0 [[CU+2]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-5781]]
+
** 1.0 Cu2+[e] '''=>''' 1.0 Cu2+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
−
* CAS : 987-78-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: in pathway=}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509]
+
{{#set: reconstruction category=manual}}
−
* CHEBI:
+
{{#set: reconstruction source=manual-import_from_medium}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779]
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307]
+
−
* HMDB : HMDB01413
+
−
{{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}}
+
−
{{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}}
+
−
{{#set: common name=CDP-choline}}
+
−
{{#set: molecular weight=487.319    }}
+
−
{{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}}
+
−
{{#set: produced by=2.7.7.15-RXN}}
+
−
{{#set: reversible reaction associated=RXN-5781}}
+

Revision as of 14:24, 21 March 2018

Reaction TransportSeed_CU+2

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Cu2+[e] => 1.0 Cu2+[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CHD-RXN&oldid=18235"