Difference between revisions of "Charged-THR-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_002810 == * left end position: ** 2078977 * transcription direction: ** POSITIVE * right end position: ** 2090254 * centisome position: ** 23.7...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_002810 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
−
* left end position:
+
* smiles:
−
** 2078977
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
−
* right end position:
+
* common name:
−
** 2090254
+
** tetrahydrogeranylgeranyl chlorophyll a
−
* centisome position:
+
* molecular weight:
−
** 23.73869    
+
** 890.479    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0165_0023
+
** tetrahydroGG-chlorophyll a
−
** Esi0165_0023
+
** tetrahydroGG-chl a
 +
** tetrahydrogeranylgeranyl-chl a
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-11989]]
+
* [[RXN-7666]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-7665]]
−
* [[RXN-11999]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-6681]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2078977}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
−
{{#set: right end position=2090254}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
{{#set: centisome position=23.73869   }}
+
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
−
{{#set: common name=Esi_0165_0023|Esi0165_0023}}
+
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
−
{{#set: reaction associated=RXN-11989|RXN-11999}}
+
{{#set: molecular weight=890.479   }}
−
{{#set: pathway associated=PWY-6681}}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
 +
{{#set: consumed by=RXN-7666}}
 +
{{#set: produced by=RXN-7665}}

Revision as of 13:24, 21 March 2018

Metabolite CPD-7006

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
  • common name:
    • tetrahydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 890.479
  • Synonym(s):
    • tetrahydroGG-chlorophyll a
    • tetrahydroGG-chl a
    • tetrahydrogeranylgeranyl-chl a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Charged-THR-tRNAs&oldid=18274"