Difference between revisions of "RXN-9535"

Revision as of 14:24, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+== Gene Ec-07_003480 ==
-* smiles:
+* left end position:
-** C(C(NC(C(O)=O)[R])=O)N
+** 3567375
-* common name:
+* transcription direction:
-** glycyl-peptide
+** POSITIVE
+* right end position:
+** 3575703
+* centisome position:
+** 46.19498
 * Synonym(s):
+** Esi_0046_0125
+** Esi0046_0125
+** putative ATCase
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[ASPCARBTRANS-RXN]]
-== Reaction(s) of unknown directionality ==
+** Source: [[annotation-esiliculosus_genome]]
-* [[2.3.1.97-RXN]]
+*** Assignment: ec-number
+** Source: [[orthology-aragem]]
+== Pathways associated ==
+* [[PWY-5686]]
 == External links  ==
-* LIGAND-CPD:
+{{#set: left end position=3567375}}
-** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038]
+{{#set: transcription direction=POSITIVE}}
-* CHEBI:
+{{#set: right end position=3575703}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462]
+{{#set: centisome position=46.19498    }}
-{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}}
+{{#set: common name=Esi_0046_0125|Esi0046_0125|putative ATCase}}
-{{#set: common name=glycyl-peptide}}
+{{#set: reaction associated=ASPCARBTRANS-RXN}}
-{{#set: reversible reaction associated=2.3.1.97-RXN}}
+{{#set: pathway associated=PWY-5686}}