Difference between revisions of "BETAINE ALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** superpathway of glucose and xylose degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''9''' reactions found over '''12''' reactions in the full pathway |
− | + | * [[2PGADEHYDRAT-RXN]] | |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Ec-14_005400]] | ||
+ | *** [[Ec-27_004000]] | ||
+ | *** [[Ec-26_004120]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[2TRANSKETO-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-20_002600]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[3PGAREARR-RXN]] | ||
+ | ** 7 associated gene(s): | ||
+ | *** [[Ec-27_000330]] | ||
+ | *** [[Ec-24_002670]] | ||
+ | *** [[Ec-10_005410]] | ||
+ | *** [[Ec-03_002160]] | ||
+ | *** [[Ec-03_002170]] | ||
+ | *** [[Ec-01_000980]] | ||
+ | *** [[Ec-06_009930]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-25_003550]] | ||
+ | *** [[Ec-19_001850]] | ||
+ | *** [[Ec-19_003020]] | ||
+ | *** [[Ec-08_000500]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[L-LACTATE-DEHYDROGENASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-12_006780]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[PENTOSE-P-PWY]] | ||
+ | ** 0 associated gene: | ||
+ | * [[PEPDEPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-26_004170]] | ||
+ | *** [[Ec-06_006860]] | ||
+ | *** [[Ec-12_000950]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Ec-12_004530]] | ||
+ | *** [[Ec-21_005710]] | ||
+ | *** [[Ec-21_004220]] | ||
+ | *** [[Ec-08_002400]] | ||
+ | *** [[Ec-12_004550]] | ||
+ | *** [[Ec-01_001350]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[XYLCAT-PWY]] | ||
+ | ** 0 associated gene: | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DLACTDEHYDROGNAD-RXN DLACTDEHYDROGNAD-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=superpathway of glucose and xylose degradation}} | |
− | + | {{#set: reaction found=9}} | |
− | {{#set: | + | {{#set: total reaction=12}} |
− | + | {{#set: completion rate=75.0}} | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:24, 21 March 2018
Pathway PWY-6901
- taxonomic range:
- common name:
- superpathway of glucose and xylose degradation
- Synonym(s):
Reaction(s) found
9 reactions found over 12 reactions in the full pathway
- 2PGADEHYDRAT-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- 2TRANSKETO-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 3PGAREARR-RXN
- 7 associated gene(s):
- 2 reconstruction source(s) associated:
- GAPOXNPHOSPHN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- L-LACTATE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PENTOSE-P-PWY
- 0 associated gene:
- PEPDEPHOS-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- PHOSGLYPHOS-RXN
- 6 associated gene(s):
- 2 reconstruction source(s) associated:
- XYLCAT-PWY
- 0 associated gene: