Difference between revisions of "Ec-13 002060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Ec-12_003860 == * left end position: ** 3592302 * transcription direction: ** POSITIVE * right end position: ** 3601085 * centisome position: ** 43.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Gene Ec-12_003860 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3592302
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(9Z)-octadecenoyl-CoA
+
** 3601085
−
* molecular weight:
+
* centisome position:
−
** 1041.936    
+
** 43.093567    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-18:1-Δ9-CoA
+
** Esi_0090_0061
−
** 3-oxo-9-cis-octadecenoyl-CoA
+
** Esi0090_0061
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[MALSYN-RXN]]
−
* [[RXN-17777]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7295]]
 +
* [[PWY-7294]]
 +
* [[GLYOXDEG-PWY]]
 +
* [[P105-PWY]]
 +
* [[GLYOXYLATE-BYPASS]]
 +
* [[PWY-6969]]
 +
* [[PWY-6728]]
 +
* [[PWY-7118]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=3592302}}
−
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: right end position=3601085}}
−
{{#set: molecular weight=1041.936   }}
+
{{#set: centisome position=43.093567   }}
−
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: common name=Esi_0090_0061|Esi0090_0061}}
−
{{#set: produced by=RXN-17777}}
+
{{#set: reaction associated=MALSYN-RXN}}
 +
{{#set: pathway associated=PWY-7295|PWY-7294|GLYOXDEG-PWY|P105-PWY|GLYOXYLATE-BYPASS|PWY-6969|PWY-6728|PWY-7118}}

Revision as of 14:24, 21 March 2018

Gene Ec-12_003860

  • left end position:
    • 3592302
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3601085
  • centisome position:
    • 43.093567
  • Synonym(s):
    • Esi_0090_0061
    • Esi0090_0061

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002060&oldid=18314"