Difference between revisions of "PWY-7688"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7243 PWY-7243] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7243 PWY-7243] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C(=O)C([O-])=O)(CO)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-dehydropantoate
+
** pectin degradation I
−
* molecular weight:
+
−
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ketopantoate
 
−
** 2-ketopantoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-14897]]
−
* [[RXN-15635]]
+
** 29 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-08_000940]]
−
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
*** [[Ec-04_001770]]
 +
*** [[Ec-08_000930]]
 +
*** [[Ec-18_004360]]
 +
*** [[Ec-13_002310]]
 +
*** [[Ec-21_001490]]
 +
*** [[Ec-14_000190]]
 +
*** [[Ec-12_000410]]
 +
*** [[Ec-00_009490]]
 +
*** [[Ec-21_003140]]
 +
*** [[Ec-02_001170]]
 +
*** [[Ec-08_000860]]
 +
*** [[Ec-00_010800]]
 +
*** [[Ec-13_002650]]
 +
*** [[Ec-20_003100]]
 +
*** [[Ec-02_001160]]
 +
*** [[Ec-14_000350]]
 +
*** [[Ec-00_006370]]
 +
*** [[Ec-23_004040]]
 +
*** [[Ec-25_001080]]
 +
*** [[Ec-08_000920]]
 +
*** [[Ec-13_002330]]
 +
*** [[Ec-09_004260]]
 +
*** [[Ec-09_004230]]
 +
*** [[Ec-00_011490]]
 +
*** [[Ec-14_004740]]
 +
*** [[Ec-20_003120]]
 +
*** [[Ec-21_001360]]
 +
*** [[Ec-13_002640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14898 RXN-14898]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03795
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
+
{{#set: common name=pectin degradation I}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
+
{{#set: total reaction=2}}
−
* CHEMSPIDER:
+
{{#set: completion rate=50.0}}
−
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
+
−
* BIGG : 36502
+
−
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
+
−
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-dehydropantoate}}
+
−
{{#set: molecular weight=145.135    }}
+
−
{{#set: common name=ketopantoate|2-ketopantoate}}
+
−
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+
−
{{#set: produced by=RXN-15635}}
+
−
{{#set: reversible reaction associated=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN}}
+

Revision as of 14:24, 21 March 2018

Pathway PWY-7243

  • taxonomic range:
  • common name:
    • pectin degradation I
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7688&oldid=18367"