Difference between revisions of "RXN3O-130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17400 CPD-17400] == * common name: ** a [glycerolipid]-lesquerolate * Synonym(s): ** a [gly...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == |
| + | * smiles: | ||
| + | ** C(C(NC(C(O)=O)[R])=O)N | ||
* common name: | * common name: | ||
| − | ** | + | ** glycyl-peptide |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.3.1.97-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462] | ||
| + | {{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}} | ||
| + | {{#set: common name=glycyl-peptide}} | ||
| + | {{#set: reversible reaction associated=2.3.1.97-RXN}} | ||
Revision as of 13:25, 21 March 2018
Contents
Metabolite GLYCYL-PEPTIDE
- smiles:
- C(C(NC(C(O)=O)[R])=O)N
- common name:
- glycyl-peptide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(NC(C(O)=O)[R])=O)N" cannot be used as a page name in this wiki.
