Difference between revisions of "PWY-1121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] == * common name: ** a [protein] N-terminal amin...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [protein] N-terminal amino acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** an N-terminal amino acid-[protein] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15564]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [protein] N-terminal amino acid}} | |
− | + | {{#set: common name=an N-terminal amino acid-[protein]}} | |
− | + | {{#set: consumed by=RXN-15564}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | + |
Revision as of 13:25, 21 March 2018
Contents
Metabolite N-terminal-Amino-Acids
- common name:
- a [protein] N-terminal amino acid
- Synonym(s):
- an N-terminal amino acid-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein] N-terminal amino acid" cannot be used as a page name in this wiki.
"an N-terminal amino acid-[protein" cannot be used as a page name in this wiki.