Difference between revisions of "TRIGLSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lysidine-tRNA-Ile2 Lysidine-tRNA-Ile2] == * common name: ** a lysidine34 in tRNAIle2 * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == |
+ | * smiles: | ||
+ | ** CC(C(=O)C([O-])=O)(CO)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 2-dehydropantoate |
+ | * molecular weight: | ||
+ | ** 145.135 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ketopantoate |
− | ** | + | ** 2-ketopantoate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2-DEHYDROPANTOATE-REDUCT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15635]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * DRUGBANK : DB03795 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561] | ||
+ | * BIGG : 36502 | ||
+ | {{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}} | ||
+ | {{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=2-dehydropantoate}} | ||
+ | {{#set: molecular weight=145.135 }} | ||
+ | {{#set: common name=ketopantoate|2-ketopantoate}} | ||
+ | {{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}} | ||
+ | {{#set: produced by=RXN-15635}} | ||
+ | {{#set: reversible reaction associated=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN}} |
Revision as of 14:25, 21 March 2018
Contents
Metabolite 2-DEHYDROPANTOATE
- smiles:
- CC(C(=O)C([O-])=O)(CO)C
- inchi key:
- InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
- common name:
- 2-dehydropantoate
- molecular weight:
- 145.135
- Synonym(s):
- ketopantoate
- 2-ketopantoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB03795
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 36502
"CC(C(=O)C([O-])=O)(CO)C" cannot be used as a page name in this wiki.