Difference between revisions of "MANNCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.7.1.4 EC-2.7.1.4] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[BETA-D-FRUCTOSE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 β-D-fructofuranose[c] '''=>''' 1 ADP[c] '''+''' 1 β-D-fructofuranose 6-phosphate[c] '''+''' 1 H+[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-18_002990]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[SUCUTIL-PWY]], sucrose degradation I (sucrose phosphotransferase): [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[SUCROSEUTIL2-PWY]], sucrose degradation VII (sucrose 3-dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEUTIL2-PWY SUCROSEUTIL2-PWY] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-4101]], D-sorbitol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY] | ||
+ | ** '''13''' reactions found over '''18''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16125 16125] |
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00760 R00760] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q09124 Q09124] |
− | * | + | ** [http://www.uniprot.org/uniprot/P24261 P24261] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q03417 Q03417] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9V0T7 Q9V0T7] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9CFI9 Q9CFI9] |
− | * | + | ** [http://www.uniprot.org/uniprot/P22824 P22824] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P26420 P26420] |
− | * | + | ** [http://www.uniprot.org/uniprot/P26984 P26984] |
− | + | ** [http://www.uniprot.org/uniprot/P37829 P37829] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43468 P43468] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P73521 P73521] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O82616 O82616] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O04897 O04897] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q42645 Q42645] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.4}} |
+ | {{#set: gene associated=Ec-18_002990}} | ||
+ | {{#set: in pathway=PWY-5384|PWY-621|SUCUTIL-PWY|SUCROSEUTIL2-PWY|PWY-4101|PWY-6531|PWY-3801|P122-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 13:26, 21 March 2018
Contents
Reaction FRUCTOKINASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 BETA-D-FRUCTOSE[c] => 1 ADP[c] + 1 FRUCTOSE-6P[c] + 1 PROTON[c]
- With common name(s):
- 1 ATP[c] + 1 β-D-fructofuranose[c] => 1 ADP[c] + 1 β-D-fructofuranose 6-phosphate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-18_002990
- Source: orthology-aragem
Pathways
- PWY-5384, sucrose degradation IV (sucrose phosphorylase): PWY-5384
- 3 reactions found over 4 reactions in the full pathway
- PWY-621, sucrose degradation III (sucrose invertase): PWY-621
- 3 reactions found over 4 reactions in the full pathway
- SUCUTIL-PWY, sucrose degradation I (sucrose phosphotransferase): SUCUTIL-PWY
- 1 reactions found over 3 reactions in the full pathway
- SUCROSEUTIL2-PWY, sucrose degradation VII (sucrose 3-dehydrogenase): SUCROSEUTIL2-PWY
- 1 reactions found over 4 reactions in the full pathway
- PWY-4101, D-sorbitol degradation I: PWY-4101
- 3 reactions found over 3 reactions in the full pathway
- PWY-6531, mannitol cycle: PWY-6531
- 4 reactions found over 5 reactions in the full pathway
- PWY-3801, sucrose degradation II (sucrose synthase): PWY-3801
- 4 reactions found over 5 reactions in the full pathway
- P122-PWY, heterolactic fermentation: P122-PWY
- 13 reactions found over 18 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: