Difference between revisions of "Ec-27 006070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** β-ketovaleryl-CoA
+
** L-cysteine biosynthesis III (from L-homocysteine)
−
* molecular weight:
+
−
** 861.604   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-homocysteine degradation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
−
* [[RXN-12561]]
+
** 1 associated gene(s):
 +
*** [[Ec-16_002870]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-14048]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_003100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15121]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15123]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-MAP:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00660 map00660]
−
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-33154}}
−
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: molecular weight=861.604    }}
+
{{#set: common name=L-cysteine biosynthesis III (from L-homocysteine)}}
−
{{#set: reversible reaction associated=RXN-12561}}
+
{{#set: common name=L-homocysteine degradation}}
 +
{{#set: reaction found=4}}
 +
{{#set: total reaction=4}}
 +
{{#set: completion rate=100.0}}

Revision as of 14:26, 21 March 2018

Pathway HOMOCYSDEGR-PWY

  • taxonomic range:
  • common name:
    • L-cysteine biosynthesis III (from L-homocysteine)
  • Synonym(s):
    • L-homocysteine degradation

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_006070&oldid=18561"