Difference between revisions of "RXN-7741"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_007580 == * left end position: ** 5251043 * transcription direction: ** NEGATIVE * right end position: ** 5258002 * centisome position: ** 59.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_007580 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
* left end position:
+
* smiles:
** 5251043
+
** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
* right end position:
+
* common name:
** 5258002
+
** cyclic-GMP
* centisome position:
+
* molecular weight:
** 59.958755    
+
** 344.2    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0028_0044
+
** 3',5'-cyclic GMP
** Esi0028_0044
+
** guanosine-cyclic-phosphoric-acid
** ND11
+
** cGMP
 +
** guanosine cyclic-monophosphate
 +
** guanosine 3',5'-cyclic-monophosphate
 +
** guanosine 3',5'-cyclic phosphate
 +
** cyclic 3',5'-guanosine monophosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NADH-DEHYDROG-A-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[GUANYLCYC-RXN]]
== Pathways associated ==
+
* [[PWY-4302]]
+
* [[PWY-3781]]
+
* [[PWY-5083]]
+
* [[PWY0-1334]]
+
* [[PWY0-1335]]
+
* [[PWY-6692]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=5251043}}
+
* CAS : 7665-99-8
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=5258002}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16727415 16727415]
{{#set: centisome position=59.958755   }}
+
* HMDB : HMDB01314
{{#set: common name=Esi_0028_0044|Esi0028_0044|ND11}}
+
* LIGAND-CPD:
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00942 C00942]
{{#set: pathway associated=PWY-4302|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-6692}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20559156.html 20559156]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57746 57746]
 +
* METABOLIGHTS : MTBLC57746
 +
{{#set: smiles=C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M}}
 +
{{#set: common name=cyclic-GMP}}
 +
{{#set: molecular weight=344.2   }}
 +
{{#set: common name=3',5'-cyclic GMP|guanosine-cyclic-phosphoric-acid|cGMP|guanosine cyclic-monophosphate|guanosine 3',5'-cyclic-monophosphate|guanosine 3',5'-cyclic phosphate|cyclic 3',5'-guanosine monophosphate}}
 +
{{#set: reversible reaction associated=GUANYLCYC-RXN}}

Revision as of 13:26, 21 March 2018

Metabolite CGMP

  • smiles:
    • C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
  • inchi key:
    • InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
  • common name:
    • cyclic-GMP
  • molecular weight:
    • 344.2
  • Synonym(s):
    • 3',5'-cyclic GMP
    • guanosine-cyclic-phosphoric-acid
    • cGMP
    • guanosine cyclic-monophosphate
    • guanosine 3',5'-cyclic-monophosphate
    • guanosine 3',5'-cyclic phosphate
    • cyclic 3',5'-guanosine monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))" cannot be used as a page name in this wiki.