Difference between revisions of "GLYOXI-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
(Created page with "Category:Gene == Gene Ec-01_006080 == * left end position: ** 5301428 * transcription direction: ** NEGATIVE * right end position: ** 5308041 * centisome position: ** 51.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Gene Ec-01_006080 ==
−
* smiles:
+
* left end position:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 5301428
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 15,16-dihydrobiliverdin
+
** 5308041
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 51.37623    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0297_0005
 +
** Esi0297_0005
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.3.7.3-RXN]]
+
* Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5301428}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5308041}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: centisome position=51.37623    }}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: common name=Esi_0297_0005|Esi0297_0005}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Revision as of 13:26, 21 March 2018

Gene Ec-01_006080

  • left end position:
    • 5301428
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5308041
  • centisome position:
    • 51.37623
  • Synonym(s):
    • Esi_0297_0005
    • Esi0297_0005

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLYOXI-RXN&oldid=18591"