Difference between revisions of "Ec-01 006080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene None == * Synonym(s): == Reactions associated == * Reaction: biomass_rxn ** Source: manual-2_biomass_rxn == Pathways associated == == Extern...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene None == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[biomass_rxn]] |
| − | == | + | ** Source: [[manual-2_biomass_rxn]] |
| − | + | == Pathways associated == | |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=biomass_rxn}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 13:26, 21 March 2018
Gene None
- Synonym(s):
Reactions associated
- Reaction: biomass_rxn
- Source: manual-2_biomass_rxn
