Difference between revisions of "GLYCEROL-KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
(Created page with "Category:Gene == Gene Ec-00_002000 == * Synonym(s): ** Esi_0013_0194 ** Esi0013_0194 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
+
== Gene Ec-00_002000 ==
* smiles:
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
* inchi key:
+
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
+
* common name:
+
** D-galactono-1,4-lactone
+
* molecular weight:
+
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
** D-galactonate-γ-lactone
+
** Esi_0013_0194
** galactono-γ-lactone
+
** Esi0013_0194
** D-galactonolactone
+
** D-galactono-γ-lactone
+
** D-galactonic acid γ-lactone
+
** γ-D-galactonolactone
+
** D-(-)-galactonic acid γ-lactone
+
** D-galactonic acid g-lactone
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[GALACTONOLACTONASE-RXN]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* CAS : 2782-07-2
+
{{#set: common name=Esi_0013_0194|Esi0013_0194}}
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
+
{{#set: pathway associated=PWY-5381}}
* HMDB : HMDB02541
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
+
{{#set: common name=D-galactono-1,4-lactone}}
+
{{#set: molecular weight=178.141    }}
+
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
+
{{#set: consumed by=GALACTONOLACTONASE-RXN}}
+

Revision as of 13:26, 21 March 2018

Gene Ec-00_002000

  • Synonym(s):
    • Esi_0013_0194
    • Esi0013_0194

Reactions associated

Pathways associated

External links