Difference between revisions of "Ec-03 003900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE PYRIDOXINE] == * smiles: ** CC1(=NC=C(C(=C1O)CO)CO) * inchi key: ** InChIKey=LXNHXLL...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14790 RXN-14790] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE PYRIDOXINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14790 RXN-14790] ==
−
* smiles:
+
* direction:
−
** CC1(=NC=C(C(=C1O)CO)CO)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LXNHXLLTXMVWPM-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** pyridoxine
+
** NAD(P)-binding domain
−
* molecular weight:
+
* ec number:
−
** 169.18   
+
** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34]
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin B6
 
−
** 2-methyl-3-hydroxy-4,5-bis(hydroxy-methyl) pyridine
 
−
** pyridoxol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PNKIN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[CPD-15661]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-15655]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 2-trans, 4-trans-undecadienoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 3-trans-undecenoyl-CoA[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_003950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7338]], 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-23-6
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 34590
+
{{#set: common name=NAD(P)-binding domain}}
−
* DRUGBANK : DB00165
+
{{#set: ec number=EC-1.3.1.34}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-16_003950}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1054 1054]
+
{{#set: in pathway=PWY-7338}}
−
* HMDB : HMDB00239
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00314 C00314]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1025.html 1025]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16709 16709]
+
−
* METABOLIGHTS : MTBLC16709
+
−
{{#set: smiles=CC1(=NC=C(C(=C1O)CO)CO)}}
+
−
{{#set: inchi key=InChIKey=LXNHXLLTXMVWPM-UHFFFAOYSA-N}}
+
−
{{#set: common name=pyridoxine}}
+
−
{{#set: molecular weight=169.18    }}
+
−
{{#set: common name=vitamin B6|2-methyl-3-hydroxy-4,5-bis(hydroxy-methyl) pyridine|pyridoxol}}
+
−
{{#set: consumed by=PNKIN-RXN}}
+

Revision as of 13:27, 21 March 2018

Reaction RXN-14790

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 2-trans, 4-trans-undecadienoyl-CoA[c] + 1 H+[c] => 1 3-trans-undecenoyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7338, 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): PWY-7338
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_003900&oldid=18712"