Difference between revisions of "Ec-24 003110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-19_002930 == * left end position: ** 3202684 * transcription direction: ** POSITIVE * right end position: ** 3212669 * centisome position: ** 53.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_002930 == |
− | * | + | * left end position: |
− | ** | + | ** 3202684 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3212669 |
− | * | + | * centisome position: |
− | ** | + | ** 53.640114 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0035_0144 |
− | ** | + | ** Esi0035_0144 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PEPCARBOXYKIN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-561]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[PWY-7117]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3202684}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3212669}} | |
− | + | {{#set: centisome position=53.640114 }} | |
− | + | {{#set: common name=Esi_0035_0144|Esi0035_0144}} | |
− | {{#set: | + | {{#set: reaction associated=PEPCARBOXYKIN-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-561|GLUCONEO-PWY|PWY-7117}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:27, 21 March 2018
Gene Ec-19_002930
- left end position:
- 3202684
- transcription direction:
- POSITIVE
- right end position:
- 3212669
- centisome position:
- 53.640114
- Synonym(s):
- Esi_0035_0144
- Esi0035_0144
Reactions associated
- Reaction: PEPCARBOXYKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome