Difference between revisions of "Ec-03 000200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221] ==
* smiles:
+
* taxonomic range:
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
* inchi key:
+
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
** gibberellin44 (open lactone form)
+
** nicotine degradation V
* molecular weight:
+
** 362.422   
+
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A44 open lactone
 
** gibberellin A44 diacid
 
** GA44 open lactone
 
** GA44 (open lactone form)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN1F-168]]
+
'''3''' reactions found over '''18''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN66-161]]
* [[RXN1F-167]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_010880]]
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-00_001320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-163]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-01_010880]]
 +
*** [[Ec-00_001320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-169]]
 +
** 3 associated gene(s):
 +
*** [[Ec-00_001320]]
 +
*** [[Ec-01_010880]]
 +
*** [[Ec-26_003280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-104 RXN66-104]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-105 RXN66-105]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-141 RXN66-141]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-142 RXN66-142]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-144 RXN66-144]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-145 RXN66-145]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-162 RXN66-162]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-164 RXN66-164]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-165 RXN66-165]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-166 RXN66-166]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-167 RXN66-167]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-168 RXN66-168]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-170 RXN66-170]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-61 RXN66-61]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-62 RXN66-62]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170008
+
{{#set: taxonomic range=TAX-40674}}
* PUBCHEM:
+
{{#set: common name=nicotine degradation V}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
{{#set: reaction found=3}}
* CHEBI:
+
{{#set: total reaction=18}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
{{#set: completion rate=17.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
{{#set: common name=gibberellin44 (open lactone form)}}
+
{{#set: molecular weight=362.422    }}
+
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
{{#set: consumed by=RXN1F-168}}
+
{{#set: produced by=RXN1F-167}}
+

Revision as of 13:27, 21 March 2018

Pathway PWY66-221

  • taxonomic range:
  • common name:
    • nicotine degradation V
  • Synonym(s):

Reaction(s) found

3 reactions found over 18 reactions in the full pathway

Reaction(s) not found

External links