Difference between revisions of "Ec-14 002880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] == * direction: ** REVERSIBLE * common name: ** P-loop c...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] ==
−
* smiles:
+
* direction:
−
** C1(C(C(C(C(C1O)O)=O)O)O)O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
+
 
* common name:
 
* common name:
−
** scyllo-inosose
+
** P-loop containing nucleoside triphosphate hydrolase
−
* molecular weight:
+
** shikimate kinase
−
** 178.141   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.1.71 EC-2.7.1.71]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-myo-inositol
 
−
** 2,4,6/3,5-pentahydroxycyclohexanone
 
−
** 2-inosose
 
−
** 2-keto-scyllo-inositol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[SHIKIMATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SHIKIMATE-5P]][c]
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
* With common name(s):
 +
** 1 shikimate[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 shikimate 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_005600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-11_000770]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13121 13121]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02412 R02412]
−
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
+
* UNIPROT:
−
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
+
** [http://www.uniprot.org/uniprot/P0A6D7 P0A6D7]
−
{{#set: common name=scyllo-inosose}}
+
** [http://www.uniprot.org/uniprot/Q9PIB5 Q9PIB5]
−
{{#set: molecular weight=178.141    }}
+
** [http://www.uniprot.org/uniprot/P07547 P07547]
−
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
+
** [http://www.uniprot.org/uniprot/P08566 P08566]
−
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+
** [http://www.uniprot.org/uniprot/P43880 P43880]
 +
** [http://www.uniprot.org/uniprot/P63600 P63600]
 +
** [http://www.uniprot.org/uniprot/Q9CEU1 Q9CEU1]
 +
** [http://www.uniprot.org/uniprot/P37944 P37944]
 +
** [http://www.uniprot.org/uniprot/P0A6E1 P0A6E1]
 +
** [http://www.uniprot.org/uniprot/P10880 P10880]
 +
** [http://www.uniprot.org/uniprot/Q00497 Q00497]
 +
** [http://www.uniprot.org/uniprot/P34003 P34003]
 +
** [http://www.uniprot.org/uniprot/P43906 P43906]
 +
** [http://www.uniprot.org/uniprot/P72796 P72796]
 +
{{#set: direction=REVERSIBLE}}
 +
{{#set: common name=P-loop containing nucleoside triphosphate hydrolase}}
 +
{{#set: common name=shikimate kinase}}
 +
{{#set: ec number=EC-2.7.1.71}}
 +
{{#set: gene associated=Ec-02_005600|Ec-11_000770}}
 +
{{#set: in pathway=PWY-6163}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 13:27, 21 March 2018

Reaction SHIKIMATE-KINASE-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • P-loop containing nucleoside triphosphate hydrolase
    • shikimate kinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 shikimate[c] + 1 ATP[c] <=> 1 ADP[c] + 1 H+[c] + 1 shikimate 3-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_002880&oldid=18771"