Difference between revisions of "GLUTAMINEFUM-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-tRNAMet Elongation-tRNAMet] == * common name: ** elongator tRNAmet * Synonym(s): **...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-tRNAMet Elongation-tRNAMet] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
* inchi key:
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
 
* common name:
 
* common name:
** cycloartenol
+
** elongator tRNAmet
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
+
** a tRNAmet
** cycloart-24(25)-enol
+
** TRNA(MET)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4021]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: common name=elongator tRNAmet}}
* PUBCHEM:
+
{{#set: common name=a tRNAmet|TRNA(MET)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657627 90657627]
+
{{#set: consumed by=METHIONINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
{{#set: consumed by=RXN-4021}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Revision as of 13:27, 21 March 2018

Metabolite Elongation-tRNAMet

  • common name:
    • elongator tRNAmet
  • Synonym(s):
    • a tRNAmet
    • TRNA(MET)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links