Difference between revisions of "P321-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** pyruvate decarboxylation to acetyl CoA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** pyruvate dehydrogenase complex |
+ | ** acetyl-CoA biosynthesis I (pyruvate dehydrogenase complex) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[RXN0-1132]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-27_004160]] |
+ | *** [[Ec-25_000020]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN0-1133]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-25_000140]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN0-1134]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-18_003420]] | ||
+ | *** [[Ec-23_002710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2157}} |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=pyruvate decarboxylation to acetyl CoA}} | |
− | + | {{#set: common name=pyruvate dehydrogenase complex|acetyl-CoA biosynthesis I (pyruvate dehydrogenase complex)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:28, 21 March 2018
Pathway PYRUVDEHYD-PWY
- taxonomic range:
- common name:
- pyruvate decarboxylation to acetyl CoA
- Synonym(s):
- pyruvate dehydrogenase complex
- acetyl-CoA biosynthesis I (pyruvate dehydrogenase complex)
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- RXN0-1132
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-1133
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-1134
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: