Difference between revisions of "RXN-15889"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS CYS] == * smiles: ** C(S)C(C(=O)[O-])[N+] * inchi key: ** InChIKey=XUJNEKJLAYXESH-REOHCLBHS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 1-18:1-2-lysophosphatidylethanolamine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 479.593 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-18:1-lysoPE |
| − | ** | + | ** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15035]] | |
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15067]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | + | * [[RXN-15036]] | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971] |
| − | * | + | * HMDB : HMDB11506 |
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=1-18:1-2-lysophosphatidylethanolamine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=479.593 }} |
| − | {{#set: common name= | + | {{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-15035}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-15067}} |
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=RXN-15036}} |
Revision as of 13:28, 21 March 2018
Contents
Metabolite CPD-8355
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
- inchi key:
- InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
- common name:
- 1-18:1-2-lysophosphatidylethanolamine
- molecular weight:
- 479.593
- Synonym(s):
- 1-18:1-lysoPE
- 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.
