Difference between revisions of "OXALACETIC ACID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5408 PWY-5408] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5408 PWY-5408] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 9-lipoxygenase and 9-hydroperoxide lyase pathway |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 9-LOX and 9-HPL pathway |
| − | ** | + | ** 9-oxo-nonanoate biosynthesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-8497]] |
| − | * [ | + | ** 4 associated gene(s): |
| + | *** [[Ec-03_000010]] | ||
| + | *** [[Ec-20_003630]] | ||
| + | *** [[Ec-20_003620]] | ||
| + | *** [[Ec-03_000020]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8495 RXN-8495] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8502 RXN-8502] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8503 RXN-8503] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=9-lipoxygenase and 9-hydroperoxide lyase pathway}} | |
| − | + | {{#set: common name=9-LOX and 9-HPL pathway|9-oxo-nonanoate biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:28, 21 March 2018
Pathway PWY-5408
- taxonomic range:
- common name:
- 9-lipoxygenase and 9-hydroperoxide lyase pathway
- Synonym(s):
- 9-LOX and 9-HPL pathway
- 9-oxo-nonanoate biosynthesis
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-8497
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
