Difference between revisions of "PWY-6897"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3081 PWY-3081] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3081 PWY-3081] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
 
* common name:
 
* common name:
** (2E,7Z)-tetradecenoyl-CoA
+
** L-lysine biosynthesis V
* molecular weight:
+
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
** 14:2-Δ2,Δ7-CoA
 
** 2-trans,7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17793]]
+
'''3''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
* [[RXN-17792]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[HOMOACONITATE-HYDRATASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-13_001950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN3O-1983]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HOMOCITRATE-SYNTHASE-RXN HOMOCITRATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15002 RXN-15002]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5182 RXN-5182]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5183 RXN-5183]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5184 RXN-5184]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5185 RXN-5185]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7970 RXN-7970]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: common name=L-lysine biosynthesis V}}
{{#set: molecular weight=969.83    }}
+
{{#set: reaction found=3}}
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: total reaction=10}}
{{#set: consumed by=RXN-17793}}
+
{{#set: completion rate=30.0}}
{{#set: produced by=RXN-17792}}
+

Revision as of 13:29, 21 March 2018

Pathway PWY-3081

  • taxonomic range:
  • common name:
    • L-lysine biosynthesis V
  • Synonym(s):

Reaction(s) found

3 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links